C28H36N4O4 — CID 144934639
tert-butyl N-[2-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]butan-2-yl]carbamate;ethane (PubChem CID 144934639) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]butan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]butan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 144934639 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | tert-butyl N-[2-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]butan-2-yl]carbamate;ethane |
| SMILES | CC.CCC(C)(NC(=O)OC(C)(C)C)c1ccc(Nc2nc(-c3ccccc3)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H30N4O4.C2H6/c1-6-26(5,29-24(31)34-25(2,3)4)19-12-14-20(15-13-19)27-23-22(30(32)33)17-16-21(28-23)18-10-8-7-9-11-18;1-2/h7-17H,6H2,1-5H3,(H,27,28)(H,29,31);1-2H3 |
| InChIKey | XYARTDGHVJMKPK-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|