C11H16N4 — CID 144934720
ethane;2-methyl-1H-pyrrolo[2,3-b]pyridine-4-carboximidamide (PubChem CID 144934720) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is ethane;2-methyl-1H-pyrrolo[2,3-b]pyridine-4-carboximidamide.
| Compound Name | ethane;2-methyl-1H-pyrrolo[2,3-b]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 144934720 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethane;2-methyl-1H-pyrrolo[2,3-b]pyridine-4-carboximidamide |
| SMILES | CC.[H]/N=C(\N)c1ccnc2[nH]c(C)cc12 |
| InChI | InChI=1S/C9H10N4.C2H6/c1-5-4-7-6(8(10)11)2-3-12-9(7)13-5;1-2/h2-4H,1H3,(H3,10,11)(H,12,13);1-2H3 |
| InChIKey | BVHQCHNOSUMBHF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|