C35H32N4 — CID 144936335
4-[2,3-bis(ethenyl)-4,4-dimethylquinolin-1-yl]naphthalen-1-amine;naphthalene-1,2-diimine (PubChem CID 144936335) has the molecular formula C35H32N4 and a molecular weight of 508.67 g/mol. Its IUPAC name is 4-[2,3-bis(ethenyl)-4,4-dimethylquinolin-1-yl]naphthalen-1-amine;naphthalene-1,2-diimine.
| Compound Name | 4-[2,3-bis(ethenyl)-4,4-dimethylquinolin-1-yl]naphthalen-1-amine;naphthalene-1,2-diimine |
|---|---|
| PubChem CID | 144936335 |
| Molecular Formula | C35H32N4 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 4-[2,3-bis(ethenyl)-4,4-dimethylquinolin-1-yl]naphthalen-1-amine;naphthalene-1,2-diimine |
| SMILES | C=CC1=C(C=C)C(C)(C)c2ccccc2N1c1ccc(N)c2ccccc12.[H]/N=C1C(=N\[H])\C=Cc2ccccc2\1 |
| InChI | InChI=1S/C25H24N2.C10H8N2/c1-5-19-22(6-2)27(24-14-10-9-13-20(24)25(19,3)4)23-16-15-21(26)17-11-7-8-12-18(17)23;11-9-6-5-7-3-1-2-4-8(7)10(9)12/h5-16H,1-2,26H2,3-4H3;1-6,11-12H/b;11-9+,12-10- |
| InChIKey | AICSEXGWSWPKGS-YAKWFZIYSA-N |
| XLogP | 8.58 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|