C27H38N8 — CID 144936697
4-(6-amino-3-pyridinyl)-N-[3-[[4-[2-(butylamino)ethyl]-3-methylpiperazin-1-yl]methyl]phenyl]pyrimidin-2-amine (PubChem CID 144936697) has the molecular formula C27H38N8 and a molecular weight of 474.66 g/mol. Its IUPAC name is 4-(6-amino-3-pyridinyl)-N-[3-[[4-[2-(butylamino)ethyl]-3-methylpiperazin-1-yl]methyl]phenyl]pyrimidin-2-amine.
| Compound Name | 4-(6-amino-3-pyridinyl)-N-[3-[[4-[2-(butylamino)ethyl]-3-methylpiperazin-1-yl]methyl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 144936697 |
| Molecular Formula | C27H38N8 |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 4-(6-amino-3-pyridinyl)-N-[3-[[4-[2-(butylamino)ethyl]-3-methylpiperazin-1-yl]methyl]phenyl]pyrimidin-2-amine |
| SMILES | CCCCNCCN1CCN(Cc2cccc(Nc3nccc(-c4ccc(N)nc4)n3)c2)CC1C |
| InChI | InChI=1S/C27H38N8/c1-3-4-11-29-13-14-35-16-15-34(19-21(35)2)20-22-6-5-7-24(17-22)32-27-30-12-10-25(33-27)23-8-9-26(28)31-18-23/h5-10,12,17-18,21,29H,3-4,11,13-16,19-20H2,1-2H3,(H2,28,31)(H,30,32,33) |
| InChIKey | CYPFQBKQRSACGE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|