C18H22N6 — CID 154461521
N-[3-[(dimethylamino)methyl]phenyl]-4-(1-ethylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 154461521) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methyl]phenyl]-4-(1-ethylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | N-[3-[(dimethylamino)methyl]phenyl]-4-(1-ethylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 154461521 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[3-[(dimethylamino)methyl]phenyl]-4-(1-ethylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | CCn1cc(-c2ccnc(Nc3cccc(CN(C)C)c3)n2)cn1 |
| InChI | InChI=1S/C18H22N6/c1-4-24-13-15(11-20-24)17-8-9-19-18(22-17)21-16-7-5-6-14(10-16)12-23(2)3/h5-11,13H,4,12H2,1-3H3,(H,19,21,22) |
| InChIKey | XBFMWWGBUYFBPT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |