C29H51O2+ — CID 144939445
[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-(2-hydroxyethyl)oxidanium (PubChem CID 144939445) has the molecular formula C29H51O2+ and a molecular weight of 431.73 g/mol. Its IUPAC name is [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-(2-hydroxyethyl)oxidanium.
| Compound Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-(2-hydroxyethyl)oxidanium |
|---|---|
| PubChem CID | 144939445 |
| Molecular Formula | C29H51O2+ |
| Molecular Weight | 431.73 g/mol |
| Exact Mass | 431.39 |
| IUPAC Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-(2-hydroxyethyl)oxidanium |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC([OH+]CCO)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H50O2/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(31-18-17-30)13-15-28(22,4)27(24)14-16-29(25,26)5/h9,20-21,23-27,30H,6-8,10-19H2,1-5H3/p+1/t21-,23?,24?,25-,26?,27?,28+,29-/m1/s1 |
| InChIKey | NPYXBHZQVNRAOF-XHXCSGAOSA-O |
| XLogP | 6.92 |
| TPSA | 33.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|