C20H19N3O4 — CID 144940290
3-ethanimidoyl-6-(furan-2-yl)-2-[(4-methoxyphenyl)methylamino]pyridine-4-carboxylic acid (PubChem CID 144940290) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-ethanimidoyl-6-(furan-2-yl)-2-[(4-methoxyphenyl)methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-ethanimidoyl-6-(furan-2-yl)-2-[(4-methoxyphenyl)methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 144940290 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-ethanimidoyl-6-(furan-2-yl)-2-[(4-methoxyphenyl)methylamino]pyridine-4-carboxylic acid |
| SMILES | [H]/N=C(\C)c1c(C(=O)O)cc(-c2ccco2)nc1NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-12(21)18-15(20(24)25)10-16(17-4-3-9-27-17)23-19(18)22-11-13-5-7-14(26-2)8-6-13/h3-10,21H,11H2,1-2H3,(H,22,23)(H,24,25)/b21-12+ |
| InChIKey | YPEYXAVCISDGPD-CIAFOILYSA-N |
| XLogP | 4.05 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|