C31H32N4O4 — CID 144792650
N-[3-[5-ethanimidoyl-6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-4-methylphenyl]-3,5-dimethoxybenzamide (PubChem CID 144792650) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is N-[3-[5-ethanimidoyl-6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-4-methylphenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-[5-ethanimidoyl-6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-4-methylphenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 144792650 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N-[3-[5-ethanimidoyl-6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-4-methylphenyl]-3,5-dimethoxybenzamide |
| SMILES | [H]/N=C(\C)c1ccc(-c2cc(NC(=O)c3cc(OC)cc(OC)c3)ccc2C)nc1NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H32N4O4/c1-19-6-9-23(34-31(36)22-14-25(38-4)17-26(15-22)39-5)16-28(19)29-13-12-27(20(2)32)30(35-29)33-18-21-7-10-24(37-3)11-8-21/h6-17,32H,18H2,1-5H3,(H,33,35)(H,34,36)/b32-20+ |
| InChIKey | AHXPFKNSCOHQHK-UZWMFBFFSA-N |
| XLogP | 6.33 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|