C24H30N4O3 — CID 144792663
N-[3-(6-amino-5-propanimidoyl-2-pyridinyl)-4-methylphenyl]-3,5-dimethoxybenzamide;molecular hydrogen (PubChem CID 144792663) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-(6-amino-5-propanimidoyl-2-pyridinyl)-4-methylphenyl]-3,5-dimethoxybenzamide;molecular hydrogen.
| Compound Name | N-[3-(6-amino-5-propanimidoyl-2-pyridinyl)-4-methylphenyl]-3,5-dimethoxybenzamide;molecular hydrogen |
|---|---|
| PubChem CID | 144792663 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[3-(6-amino-5-propanimidoyl-2-pyridinyl)-4-methylphenyl]-3,5-dimethoxybenzamide;molecular hydrogen |
| SMILES | [H]/N=C(\CC)c1ccc(-c2cc(NC(=O)c3cc(OC)cc(OC)c3)ccc2C)nc1N.[H][H].[H][H] |
| InChI | InChI=1S/C24H26N4O3.2H2/c1-5-21(25)19-8-9-22(28-23(19)26)20-12-16(7-6-14(20)2)27-24(29)15-10-17(30-3)13-18(11-15)31-4;;/h6-13,25H,5H2,1-4H3,(H2,26,28)(H,27,29);2*1H/b25-21+;; |
| InChIKey | LZEIBTNEOZGFMF-WPUCSEBPSA-N |
| XLogP | 5.18 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|