C20H17Cl2N3O2 — CID 10201098
6-chloro-N-(4-chlorophenyl)-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxamide (PubChem CID 10201098) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 6-chloro-N-(4-chlorophenyl)-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(4-chlorophenyl)-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10201098 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 6-chloro-N-(4-chlorophenyl)-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxamide |
| SMILES | COc1ccc(CNc2nc(Cl)ccc2C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c1-27-16-8-2-13(3-9-16)12-23-19-17(10-11-18(22)25-19)20(26)24-15-6-4-14(21)5-7-15/h2-11H,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | WSYHESLLOFKCFE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|