C21H19ClFN3O2 — CID 90757999
N-[6-chloro-2-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-3-fluoro-4-methylbenzamide (PubChem CID 90757999) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is N-[6-chloro-2-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[6-chloro-2-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 90757999 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[6-chloro-2-[(4-methoxyphenyl)methylamino]-3-pyridinyl]-3-fluoro-4-methylbenzamide |
| SMILES | COc1ccc(CNc2nc(Cl)ccc2NC(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C21H19ClFN3O2/c1-13-3-6-15(11-17(13)23)21(27)25-18-9-10-19(22)26-20(18)24-12-14-4-7-16(28-2)8-5-14/h3-11H,12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | LVHCQHMTBSDOGO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|