C32H46N2O7 — CID 144941460
(3,5,5-trimethyl-6-nitrooxyhexan-3-yl) (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate (PubChem CID 144941460) has the molecular formula C32H46N2O7 and a molecular weight of 570.73 g/mol. Its IUPAC name is (3,5,5-trimethyl-6-nitrooxyhexan-3-yl) (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate.
| Compound Name | (3,5,5-trimethyl-6-nitrooxyhexan-3-yl) (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 144941460 |
| Molecular Formula | C32H46N2O7 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | (3,5,5-trimethyl-6-nitrooxyhexan-3-yl) (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate |
| SMILES | CCC(C)(CC(C)(C)CO[N+](=O)[O-])OC(=O)[C@H](C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H46N2O7/c1-9-32(8,21-31(6,7)22-39-34(37)38)40-28(35)23(2)19-27(33-29(36)41-30(3,4)5)20-24-15-17-26(18-16-24)25-13-11-10-12-14-25/h10-18,23,27H,9,19-22H2,1-8H3,(H,33,36)/t23-,27+,32?/m1/s1 |
| InChIKey | JFUOWURTPZYQHT-ZBMYXVKESA-N |
| XLogP | 7.15 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|