C42H41BN2O2 — CID 144941654
ethane;1-phenyl-5-[3-(1-phenylindol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole (PubChem CID 144941654) has the molecular formula C42H41BN2O2 and a molecular weight of 616.61 g/mol. Its IUPAC name is ethane;1-phenyl-5-[3-(1-phenylindol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole.
| Compound Name | ethane;1-phenyl-5-[3-(1-phenylindol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole |
|---|---|
| PubChem CID | 144941654 |
| Molecular Formula | C42H41BN2O2 |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | ethane;1-phenyl-5-[3-(1-phenylindol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole |
| SMILES | CC.CC1(C)OB(c2cc(-c3ccc4c(ccn4-c4ccccc4)c3)cc(-c3ccc4c(ccn4-c4ccccc4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C40H35BN2O2.C2H6/c1-39(2)40(3,4)45-41(44-39)34-26-32(28-15-17-37-30(23-28)19-21-42(37)35-11-7-5-8-12-35)25-33(27-34)29-16-18-38-31(24-29)20-22-43(38)36-13-9-6-10-14-36;1-2/h5-27H,1-4H3;1-2H3 |
| InChIKey | OGEQFCKIOGZVTO-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|