C42H35N3 — CID 144941684
1,3-bis(1-phenylindol-5-yl)-9H-carbazole;ethane;molecular hydrogen (PubChem CID 144941684) has the molecular formula C42H35N3 and a molecular weight of 581.76 g/mol. Its IUPAC name is 1,3-bis(1-phenylindol-5-yl)-9H-carbazole;ethane;molecular hydrogen.
| Compound Name | 1,3-bis(1-phenylindol-5-yl)-9H-carbazole;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144941684 |
| Molecular Formula | C42H35N3 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 1,3-bis(1-phenylindol-5-yl)-9H-carbazole;ethane;molecular hydrogen |
| SMILES | CC.[H][H].c1ccc(-n2ccc3cc(-c4cc(-c5ccc6c(ccn6-c6ccccc6)c5)c5[nH]c6ccccc6c5c4)ccc32)cc1 |
| InChI | InChI=1S/C40H27N3.C2H6.H2/c1-3-9-32(10-4-1)42-21-19-29-23-27(15-17-38(29)42)31-25-35(40-36(26-31)34-13-7-8-14-37(34)41-40)28-16-18-39-30(24-28)20-22-43(39)33-11-5-2-6-12-33;1-2;/h1-26,41H;1-2H3;1H |
| InChIKey | CLFJOXHNUZUVEB-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 25.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |