C19H23NO4 — CID 144941783
(Z)-4-hydroxy-1-[(2R,10R)-5-methoxy-11-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]but-2-en-1-one (PubChem CID 144941783) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (Z)-4-hydroxy-1-[(2R,10R)-5-methoxy-11-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]but-2-en-1-one.
| Compound Name | (Z)-4-hydroxy-1-[(2R,10R)-5-methoxy-11-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 144941783 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (Z)-4-hydroxy-1-[(2R,10R)-5-methoxy-11-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]but-2-en-1-one |
| SMILES | COc1ccc2c3c1O[C@@H](C(=O)/C=C\CO)C31CCN(C)[C@H](C2)C1 |
| InChI | InChI=1S/C19H23NO4/c1-20-8-7-19-11-13(20)10-12-5-6-15(23-2)17(16(12)19)24-18(19)14(22)4-3-9-21/h3-6,13,18,21H,7-11H2,1-2H3/b4-3-/t13-,18+,19?/m1/s1 |
| InChIKey | UNBWCIMCWLHMCP-XTCMOWBUSA-N |
| XLogP | 1.46 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|