C22H27NO5 — CID 22826316
[(1S,5R,13S,14S,17R,19R)-10-methoxy-4-methyl-12,16-dioxa-4-azahexacyclo[9.8.1.01,13.05,19.07,20.014,17]icosa-7(20),8,10-trien-17-yl]methyl acetate (PubChem CID 22826316) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(1S,5R,13S,14S,17R,19R)-10-methoxy-4-methyl-12,16-dioxa-4-azahexacyclo[9.8.1.01,13.05,19.07,20.014,17]icosa-7(20),8,10-trien-17-yl]methyl acetate.
| Compound Name | [(1S,5R,13S,14S,17R,19R)-10-methoxy-4-methyl-12,16-dioxa-4-azahexacyclo[9.8.1.01,13.05,19.07,20.014,17]icosa-7(20),8,10-trien-17-yl]methyl acetate |
|---|---|
| PubChem CID | 22826316 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [(1S,5R,13S,14S,17R,19R)-10-methoxy-4-methyl-12,16-dioxa-4-azahexacyclo[9.8.1.01,13.05,19.07,20.014,17]icosa-7(20),8,10-trien-17-yl]methyl acetate |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H]4CO[C@]4(COC(C)=O)C[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C22H27NO5/c1-12(24)26-11-21-9-14-16-8-13-4-5-17(25-3)19-18(13)22(14,6-7-23(16)2)20(28-19)15(21)10-27-21/h4-5,14-16,20H,6-11H2,1-3H3/t14-,15-,16+,20-,21-,22-/m0/s1 |
| InChIKey | LBPFUXGZICPUAO-UWXVGGGXSA-N |
| XLogP | 1.92 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |