C23H34ClNO4 — CID 52942996
(6R,7R)-6-butyl-6-(hydroxymethyl)-9-methoxy-3-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;hydrochloride (PubChem CID 52942996) has the molecular formula C23H34ClNO4 and a molecular weight of 423.98 g/mol. Its IUPAC name is (6R,7R)-6-butyl-6-(hydroxymethyl)-9-methoxy-3-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;hydrochloride.
| Compound Name | (6R,7R)-6-butyl-6-(hydroxymethyl)-9-methoxy-3-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;hydrochloride |
|---|---|
| PubChem CID | 52942996 |
| Molecular Formula | C23H34ClNO4 |
| Molecular Weight | 423.98 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (6R,7R)-6-butyl-6-(hydroxymethyl)-9-methoxy-3-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;hydrochloride |
| SMILES | CCCC[C@]1(CO)CC2C3Cc4ccc(OC)c5c4C2(CCN3C)C(O5)[C@@H]1O.Cl |
| InChI | InChI=1S/C23H33NO4.ClH/c1-4-5-8-22(13-25)12-15-16-11-14-6-7-17(27-3)19-18(14)23(15,9-10-24(16)2)21(28-19)20(22)26;/h6-7,15-16,20-21,25-26H,4-5,8-13H2,1-3H3;1H/t15?,16?,20-,21?,22+,23?;/m0./s1 |
| InChIKey | NQKUOSFIECALCP-ZJXIREJVSA-N |
| XLogP | 2.93 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |