About (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane
(3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane (PubChem CID 144942230) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane.
Molecular Properties
| Compound Name | (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane |
| PubChem CID | 144942230 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane |
| SMILES | CC.CC1(C)CCN(C(=O)[C@]2(C)CCN2)C1 |
| InChI | InChI=1S/C11H20N2O.C2H6/c1-10(2)5-7-13(8-10)9(14)11(3)4-6-12-11;1-2/h12H,4-8H2,1-3H3;1-2H3/t11-;/m0./s1 |
| InChIKey | FBSLZDVPEWNUEK-MERQFXBCSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane?
The IUPAC name of (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane (CID 144942230) is (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane.
What is the SMILES notation for (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane?
The canonical SMILES for (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane is CC.CC1(C)CCN(C(=O)[C@]2(C)CCN2)C1.
What is the InChIKey of (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane?
The InChIKey is FBSLZDVPEWNUEK-MERQFXBCSA-N. The full InChI is InChI=1S/C11H20N2O.C2H6/c1-10(2)5-7-13(8-10)9(14)11(3)4-6-12-11;1-2/h12H,4-8H2,1-3H3;1-2H3/t11-;/m0./s1.
What are the key properties of (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane?
(3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane has a molecular weight of 226.36 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethylpyrrolidin-1-yl)-[(2S)-2-methylazetidin-2-yl]methanone;ethane is sourced from PubChem (CID 144942230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).