C43H33N5 — CID 144943179
3-[6-[3-(11,11-dimethyl-9,10-dihydroindeno[1,2-b]carbazol-5-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 144943179) has the molecular formula C43H33N5 and a molecular weight of 619.77 g/mol. Its IUPAC name is 3-[6-[3-(11,11-dimethyl-9,10-dihydroindeno[1,2-b]carbazol-5-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 3-[6-[3-(11,11-dimethyl-9,10-dihydroindeno[1,2-b]carbazol-5-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 144943179 |
| Molecular Formula | C43H33N5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 3-[6-[3-(11,11-dimethyl-9,10-dihydroindeno[1,2-b]carbazol-5-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CC1(C)C2=C(C=CCC2)c2cc3c(cc21)c1ccccc1n3-c1cccc(C2=NC(c3ccccc3)N=C(c3cccc(C#N)c3)N2)c1 |
| InChI | InChI=1S/C43H33N5/c1-43(2)36-20-8-6-18-32(36)34-25-39-35(24-37(34)43)33-19-7-9-21-38(33)48(39)31-17-11-16-30(23-31)42-46-40(28-13-4-3-5-14-28)45-41(47-42)29-15-10-12-27(22-29)26-44/h3-7,9-19,21-25,40H,8,20H2,1-2H3,(H,45,46,47) |
| InChIKey | ROYBDHDWGATTQB-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |