C38H64FN — CID 144944911
(5aR)-9-[4-(fluoromethyl)cyclohexen-1-yl]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine;ethane;prop-1-ene (PubChem CID 144944911) has the molecular formula C38H64FN and a molecular weight of 553.94 g/mol. Its IUPAC name is (5aR)-9-[4-(fluoromethyl)cyclohexen-1-yl]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine;ethane;prop-1-ene.
| Compound Name | (5aR)-9-[4-(fluoromethyl)cyclohexen-1-yl]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144944911 |
| Molecular Formula | C38H64FN |
| Molecular Weight | 553.94 g/mol |
| Exact Mass | 553.50 |
| IUPAC Name | (5aR)-9-[4-(fluoromethyl)cyclohexen-1-yl]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC1(C)C(C2=CCC(CF)CC2)=CCC2(C)C1CCC1(C)C2CCC2C3CCCC3(N)CC[C@]21C |
| InChI | InChI=1S/C33H52FN.C3H6.C2H6/c1-29(2)24(23-10-8-22(21-34)9-11-23)14-17-30(3)27(29)15-18-32(5)28(30)13-12-25-26-7-6-16-33(26,35)20-19-31(25,32)4;1-3-2;1-2/h10,14,22,25-28H,6-9,11-13,15-21,35H2,1-5H3;3H,1H2,2H3;1-2H3/t22?,25?,26?,27?,28?,30?,31-,32?,33?;;/m1../s1 |
| InChIKey | IWEGRLZQOCEUQD-JGBRICJFSA-N |
| XLogP | 11.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.94 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|