C26H43N — CID 144944908
(5aR,7aS,11bR,13bR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine (PubChem CID 144944908) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is (5aR,7aS,11bR,13bR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine.
| Compound Name | (5aR,7aS,11bR,13bR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine |
|---|---|
| PubChem CID | 144944908 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | (5aR,7aS,11bR,13bR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-amine |
| SMILES | CC1(C)C=CCC2(C)[C@H]3CCC4[C@H]5CCCC5(N)CC[C@@]4(C)C3(C)CC[C@@H]12 |
| InChI | InChI=1S/C26H43N/c1-22(2)12-7-13-23(3)20(22)11-15-25(5)21(23)10-9-18-19-8-6-14-26(19,27)17-16-24(18,25)4/h7,12,18-21H,6,8-11,13-17,27H2,1-5H3/t18?,19-,20+,21-,23?,24-,25?,26?/m1/s1 |
| InChIKey | SKFUTDIWYDDLOC-FHGDNZPZSA-N |
| XLogP | 6.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|