C20H20ClF3OS2 — CID 144945950
2-(2-chloro-5-methylsulfanylphenyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane (PubChem CID 144945950) has the molecular formula C20H20ClF3OS2 and a molecular weight of 432.96 g/mol. Its IUPAC name is 2-(2-chloro-5-methylsulfanylphenyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane.
| Compound Name | 2-(2-chloro-5-methylsulfanylphenyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane |
|---|---|
| PubChem CID | 144945950 |
| Molecular Formula | C20H20ClF3OS2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-(2-chloro-5-methylsulfanylphenyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane |
| SMILES | CSc1ccc(Cl)c(C2CC(C)(Sc3cccc(C(F)(F)F)c3)CCO2)c1 |
| InChI | InChI=1S/C20H20ClF3OS2/c1-19(27-15-5-3-4-13(10-15)20(22,23)24)8-9-25-18(12-19)16-11-14(26-2)6-7-17(16)21/h3-7,10-11,18H,8-9,12H2,1-2H3 |
| InChIKey | GNYANPLWJAOUNH-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |