C6H8BrN — CID 144946054
(2Z)-N-methylpenta-2,4-dienimidoyl bromide (PubChem CID 144946054) has the molecular formula C6H8BrN and a molecular weight of 174.04 g/mol. Its IUPAC name is (2Z)-N-methylpenta-2,4-dienimidoyl bromide.
| Compound Name | (2Z)-N-methylpenta-2,4-dienimidoyl bromide |
|---|---|
| PubChem CID | 144946054 |
| Molecular Formula | C6H8BrN |
| Molecular Weight | 174.04 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | (2Z)-N-methylpenta-2,4-dienimidoyl bromide |
| SMILES | C=C/C=C\C(Br)=N\C |
| InChI | InChI=1S/C6H8BrN/c1-3-4-5-6(7)8-2/h3-5H,1H2,2H3/b5-4-,8-6- |
| InChIKey | NUUHNGNXRNEDSR-NADLECRISA-N |
| XLogP | 2.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.04 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|