About (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane
(2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane (PubChem CID 169108769) has the molecular formula C8H13BrFN
and a molecular weight of 222.10 g/mol. Its IUPAC name is (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane.
Molecular Properties
| Compound Name | (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane |
| PubChem CID | 169108769 |
| Molecular Formula | C8H13BrFN |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane |
| SMILES | C=C/C=C(Br)\C(F)=N\C.CC |
| InChI | InChI=1S/C6H7BrFN.C2H6/c1-3-4-5(7)6(8)9-2;1-2/h3-4H,1H2,2H3;1-2H3/b5-4+,9-6-; |
| InChIKey | FOYVHFCCSRGFOE-ONYQRONRSA-N |
| XLogP | 3.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane?
The IUPAC name of (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane (CID 169108769) is (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane.
What is the SMILES notation for (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane?
The canonical SMILES for (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane is C=C/C=C(Br)\C(F)=N\C.CC.
What is the InChIKey of (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane?
The InChIKey is FOYVHFCCSRGFOE-ONYQRONRSA-N. The full InChI is InChI=1S/C6H7BrFN.C2H6/c1-3-4-5(7)6(8)9-2;1-2/h3-4H,1H2,2H3;1-2H3/b5-4+,9-6-;.
What are the key properties of (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane?
(2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane has a molecular weight of 222.10 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-bromo-N-methylpenta-2,4-dienimidoyl fluoride;ethane is sourced from PubChem (CID 169108769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).