C7H11NS — CID 144946163
2-but-3-en-2-yl-4,5-dihydro-1,3-thiazole (PubChem CID 144946163) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 2-but-3-en-2-yl-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-but-3-en-2-yl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 144946163 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-but-3-en-2-yl-4,5-dihydro-1,3-thiazole |
| SMILES | C=CC(C)C1=NCCS1 |
| InChI | InChI=1S/C7H11NS/c1-3-6(2)7-8-4-5-9-7/h3,6H,1,4-5H2,2H3 |
| InChIKey | LADXLVKXNYAXRP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|