C9H15NS — CID 132962086
2-[(3S)-hex-5-en-3-yl]-4,5-dihydro-1,3-thiazole (PubChem CID 132962086) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 2-[(3S)-hex-5-en-3-yl]-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-[(3S)-hex-5-en-3-yl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 132962086 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-[(3S)-hex-5-en-3-yl]-4,5-dihydro-1,3-thiazole |
| SMILES | C=CC[C@H](CC)C1=NCCS1 |
| InChI | InChI=1S/C9H15NS/c1-3-5-8(4-2)9-10-6-7-11-9/h3,8H,1,4-7H2,2H3/t8-/m0/s1 |
| InChIKey | XWVDOAXTPWUWAT-QMMMGPOBSA-N |
| XLogP | 2.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|