C9H13NS — CID 90893189
N-ethenyl-4-ethyl-3,4-dihydrothiopyran-2-imine (PubChem CID 90893189) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N-ethenyl-4-ethyl-3,4-dihydrothiopyran-2-imine.
| Compound Name | N-ethenyl-4-ethyl-3,4-dihydrothiopyran-2-imine |
|---|---|
| PubChem CID | 90893189 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-ethenyl-4-ethyl-3,4-dihydrothiopyran-2-imine |
| SMILES | C=C/N=C1/CC(CC)C=CS1 |
| InChI | InChI=1S/C9H13NS/c1-3-8-5-6-11-9(7-8)10-4-2/h4-6,8H,2-3,7H2,1H3/b10-9- |
| InChIKey | OKSZTRNVAWVCRH-KTKRTIGZSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|