C15H21NS — CID 135040542
(3R,4S)-4-(2-methylprop-2-enyl)-3-prop-2-enyl-2-prop-2-enylsulfanyl-3,4-dihydropyridine (PubChem CID 135040542) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is (3R,4S)-4-(2-methylprop-2-enyl)-3-prop-2-enyl-2-prop-2-enylsulfanyl-3,4-dihydropyridine.
| Compound Name | (3R,4S)-4-(2-methylprop-2-enyl)-3-prop-2-enyl-2-prop-2-enylsulfanyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 135040542 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (3R,4S)-4-(2-methylprop-2-enyl)-3-prop-2-enyl-2-prop-2-enylsulfanyl-3,4-dihydropyridine |
| SMILES | C=CCSC1=NC=C[C@H](CC(=C)C)[C@H]1CC=C |
| InChI | InChI=1S/C15H21NS/c1-5-7-14-13(11-12(3)4)8-9-16-15(14)17-10-6-2/h5-6,8-9,13-14H,1-3,7,10-11H2,4H3/t13-,14-/m1/s1 |
| InChIKey | CSFWKGMCONVBQX-ZIAGYGMSSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|