C6H11N3O — CID 144946520
N-[(Z)-3-amino-2-methanimidoylprop-2-enyl]acetamide (PubChem CID 144946520) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is N-[(Z)-3-amino-2-methanimidoylprop-2-enyl]acetamide.
| Compound Name | N-[(Z)-3-amino-2-methanimidoylprop-2-enyl]acetamide |
|---|---|
| PubChem CID | 144946520 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | N-[(Z)-3-amino-2-methanimidoylprop-2-enyl]acetamide |
| SMILES | [H]/N=C/C(=C\N)CNC(C)=O |
| InChI | InChI=1S/C6H11N3O/c1-5(10)9-4-6(2-7)3-8/h2-3,7H,4,8H2,1H3,(H,9,10)/b6-3+,7-2+ |
| InChIKey | ZCLPUNYSBVLQNV-LXYHSKMQSA-N |
| XLogP | -0.39 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|