C8H13N3O — CID 144904331
N-[(Z)-3-(methylideneamino)-2-(methyliminomethyl)prop-2-enyl]acetamide (PubChem CID 144904331) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is N-[(Z)-3-(methylideneamino)-2-(methyliminomethyl)prop-2-enyl]acetamide.
| Compound Name | N-[(Z)-3-(methylideneamino)-2-(methyliminomethyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 144904331 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-[(Z)-3-(methylideneamino)-2-(methyliminomethyl)prop-2-enyl]acetamide |
| SMILES | C=N/C=C(\C=N\C)CNC(C)=O |
| InChI | InChI=1S/C8H13N3O/c1-7(12)11-6-8(4-9-2)5-10-3/h4-5H,2,6H2,1,3H3,(H,11,12)/b8-4+,10-5+ |
| InChIKey | BDCWDFDIWCBAND-DXNUHORPSA-N |
| XLogP | 0.41 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|