C13H26N2O — CID 142506758
ethane;N-[3-(ethenyliminomethyl)but-3-enyl]acetamide (PubChem CID 142506758) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is ethane;N-[3-(ethenyliminomethyl)but-3-enyl]acetamide.
| Compound Name | ethane;N-[3-(ethenyliminomethyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 142506758 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | ethane;N-[3-(ethenyliminomethyl)but-3-enyl]acetamide |
| SMILES | C=C/N=C/C(=C)CCNC(C)=O.CC.CC |
| InChI | InChI=1S/C9H14N2O.2C2H6/c1-4-10-7-8(2)5-6-11-9(3)12;2*1-2/h4,7H,1-2,5-6H2,3H3,(H,11,12);2*1-2H3/b10-7+;; |
| InChIKey | BHLSZGXRGONBBQ-WRQJSNHTSA-N |
| XLogP | 3.34 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|