About N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen
N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen (PubChem CID 145197652) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen |
| PubChem CID | 145197652 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen |
| SMILES | C=C(/C=N/C(=C)C)CC(=O)NCCN.CC.[H][H] |
| InChI | InChI=1S/C10H17N3O.C2H6.H2/c1-8(2)13-7-9(3)6-10(14)12-5-4-11;1-2;/h7H,1,3-6,11H2,2H3,(H,12,14);1-2H3;1H/b13-7+;; |
| InChIKey | XGVUNLZPNGIXRT-JOZOFPPJSA-N |
| XLogP | 1.88 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen?
The IUPAC name of N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen (CID 145197652) is N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen.
What is the SMILES notation for N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen?
The canonical SMILES for N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen is C=C(/C=N/C(=C)C)CC(=O)NCCN.CC.[H][H].
What is the InChIKey of N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen?
The InChIKey is XGVUNLZPNGIXRT-JOZOFPPJSA-N. The full InChI is InChI=1S/C10H17N3O.C2H6.H2/c1-8(2)13-7-9(3)6-10(14)12-5-4-11;1-2;/h7H,1,3-6,11H2,2H3,(H,12,14);1-2H3;1H/b13-7+;;.
What are the key properties of N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen?
N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen has a molecular weight of 227.35 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-3-(prop-1-en-2-yliminomethyl)but-3-enamide;ethane;molecular hydrogen is sourced from PubChem (CID 145197652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).