C18H38N2O6 — CID 168904058
ethane;2-[4-(2-methylprop-2-enoxy)butanoyloxy]ethyl 4-(2-aminoethylamino)-4-oxobutanoate;molecular hydrogen (PubChem CID 168904058) has the molecular formula C18H38N2O6 and a molecular weight of 378.51 g/mol. Its IUPAC name is ethane;2-[4-(2-methylprop-2-enoxy)butanoyloxy]ethyl 4-(2-aminoethylamino)-4-oxobutanoate;molecular hydrogen.
| Compound Name | ethane;2-[4-(2-methylprop-2-enoxy)butanoyloxy]ethyl 4-(2-aminoethylamino)-4-oxobutanoate;molecular hydrogen |
|---|---|
| PubChem CID | 168904058 |
| Molecular Formula | C18H38N2O6 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | ethane;2-[4-(2-methylprop-2-enoxy)butanoyloxy]ethyl 4-(2-aminoethylamino)-4-oxobutanoate;molecular hydrogen |
| SMILES | C=C(C)COCCCC(=O)OCCOC(=O)CCC(=O)NCCN.CC.[H][H].[H][H] |
| InChI | InChI=1S/C16H28N2O6.C2H6.2H2/c1-13(2)12-22-9-3-4-15(20)23-10-11-24-16(21)6-5-14(19)18-8-7-17;1-2;;/h1,3-12,17H2,2H3,(H,18,19);1-2H3;2*1H |
| InChIKey | KFOHNEIVKXJPKZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|