C10H20N2O — CID 143723815
ethane;N-[(Z)-4-(ethylideneamino)but-3-enyl]acetamide (PubChem CID 143723815) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is ethane;N-[(Z)-4-(ethylideneamino)but-3-enyl]acetamide.
| Compound Name | ethane;N-[(Z)-4-(ethylideneamino)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 143723815 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;N-[(Z)-4-(ethylideneamino)but-3-enyl]acetamide |
| SMILES | C/C=N/C=C\CCNC(C)=O.CC |
| InChI | InChI=1S/C8H14N2O.C2H6/c1-3-9-6-4-5-7-10-8(2)11;1-2/h3-4,6H,5,7H2,1-2H3,(H,10,11);1-2H3/b6-4-,9-3+; |
| InChIKey | DARUMRIYKYJXDJ-ANZGCBAVSA-N |
| XLogP | 2.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|