C11H21N3O — CID 90245678
(Z)-N-[3-[ethyl(methyl)amino]propyl]-4-(methylideneamino)but-3-enamide (PubChem CID 90245678) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (Z)-N-[3-[ethyl(methyl)amino]propyl]-4-(methylideneamino)but-3-enamide.
| Compound Name | (Z)-N-[3-[ethyl(methyl)amino]propyl]-4-(methylideneamino)but-3-enamide |
|---|---|
| PubChem CID | 90245678 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (Z)-N-[3-[ethyl(methyl)amino]propyl]-4-(methylideneamino)but-3-enamide |
| SMILES | C=N/C=C\CC(=O)NCCCN(C)CC |
| InChI | InChI=1S/C11H21N3O/c1-4-14(3)10-6-9-13-11(15)7-5-8-12-2/h5,8H,2,4,6-7,9-10H2,1,3H3,(H,13,15)/b8-5- |
| InChIKey | RVFKLSMJHFHPLZ-YVMONPNESA-N |
| XLogP | 1.05 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|