C17H34N2O — CID 143529169
ethane;N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide (PubChem CID 143529169) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide.
| Compound Name | ethane;N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 143529169 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | ethane;N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide |
| SMILES | C=C/N=C/C(=C\C)CCNC(=O)C(C)(C)C.CC.CC |
| InChI | InChI=1S/C13H22N2O.2C2H6/c1-6-11(10-14-7-2)8-9-15-12(16)13(3,4)5;2*1-2/h6-7,10H,2,8-9H2,1,3-5H3,(H,15,16);2*1-2H3/b11-6-,14-10+;; |
| InChIKey | VQGJICIHAZTFJE-OTIMAZQKSA-N |
| XLogP | 4.75 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|