C10H16N2O — CID 59561910
N-[2-(3H-pyrrol-4-yl)ethyl]butanamide (PubChem CID 59561910) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[2-(3H-pyrrol-4-yl)ethyl]butanamide.
| Compound Name | N-[2-(3H-pyrrol-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 59561910 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[2-(3H-pyrrol-4-yl)ethyl]butanamide |
| SMILES | CCCC(=O)NCCC1=CN=CC1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-10(13)12-7-5-9-4-6-11-8-9/h6,8H,2-5,7H2,1H3,(H,12,13) |
| InChIKey | RSOVEUSTASVKFV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |