C10H17N3O — CID 123749557
3-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]propanamide (PubChem CID 123749557) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]propanamide.
| Compound Name | 3-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 123749557 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]propanamide |
| SMILES | NCCC(=O)NCCC1=CN=CCC1 |
| InChI | InChI=1S/C10H17N3O/c11-5-3-10(14)13-7-4-9-2-1-6-12-8-9/h6,8H,1-5,7,11H2,(H,13,14) |
| InChIKey | UMNVGLNBFLPTKM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |