C11H19N3O — CID 123553028
4-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]butanamide (PubChem CID 123553028) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]butanamide.
| Compound Name | 4-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 123553028 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-amino-N-[2-(3,4-dihydropyridin-5-yl)ethyl]butanamide |
| SMILES | NCCCC(=O)NCCC1=CN=CCC1 |
| InChI | InChI=1S/C11H19N3O/c12-6-1-4-11(15)14-8-5-10-3-2-7-13-9-10/h7,9H,1-6,8,12H2,(H,14,15) |
| InChIKey | SRAYEXLCEJHXAN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |