C10H18N2O — CID 142069991
molecular hydrogen;N-[3-(3H-pyrrol-3-yl)propyl]propanamide (PubChem CID 142069991) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is molecular hydrogen;N-[3-(3H-pyrrol-3-yl)propyl]propanamide.
| Compound Name | molecular hydrogen;N-[3-(3H-pyrrol-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 142069991 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | molecular hydrogen;N-[3-(3H-pyrrol-3-yl)propyl]propanamide |
| SMILES | CCC(=O)NCCCC1C=CN=C1.[H][H] |
| InChI | InChI=1S/C10H16N2O.H2/c1-2-10(13)12-6-3-4-9-5-7-11-8-9;/h5,7-9H,2-4,6H2,1H3,(H,12,13);1H |
| InChIKey | MTWHDAHQPGOJSS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|