C11H16N2O2 — CID 144507815
N-(4-oxopentyl)-3,4-dihydropyridine-3-carboxamide (PubChem CID 144507815) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N-(4-oxopentyl)-3,4-dihydropyridine-3-carboxamide.
| Compound Name | N-(4-oxopentyl)-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 144507815 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(4-oxopentyl)-3,4-dihydropyridine-3-carboxamide |
| SMILES | CC(=O)CCCNC(=O)C1C=NC=CC1 |
| InChI | InChI=1S/C11H16N2O2/c1-9(14)4-2-7-13-11(15)10-5-3-6-12-8-10/h3,6,8,10H,2,4-5,7H2,1H3,(H,13,15) |
| InChIKey | YCNWBYCXPIHHHT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|