C20H22ClN5O — CID 144947531
2-[[4-(aminomethyl)phenyl]methylamino]-6-chloro-4-(1-cyclopropylethyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 144947531) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]methylamino]-6-chloro-4-(1-cyclopropylethyl)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 2-[[4-(aminomethyl)phenyl]methylamino]-6-chloro-4-(1-cyclopropylethyl)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 144947531 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]methylamino]-6-chloro-4-(1-cyclopropylethyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | CC(C1CC1)n1c(=O)c(NCc2ccc(CN)cc2)nc2ccc(Cl)nc21 |
| InChI | InChI=1S/C20H22ClN5O/c1-12(15-6-7-15)26-19-16(8-9-17(21)25-19)24-18(20(26)27)23-11-14-4-2-13(10-22)3-5-14/h2-5,8-9,12,15H,6-7,10-11,22H2,1H3,(H,23,24) |
| InChIKey | QYARGKDKDAGXQW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|