C24H28N4O4S2 — CID 144948148
ethanimidoyl 4-[5-(2-methylsulfinylethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate (PubChem CID 144948148) has the molecular formula C24H28N4O4S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is ethanimidoyl 4-[5-(2-methylsulfinylethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate.
| Compound Name | ethanimidoyl 4-[5-(2-methylsulfinylethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate |
|---|---|
| PubChem CID | 144948148 |
| Molecular Formula | C24H28N4O4S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | ethanimidoyl 4-[5-(2-methylsulfinylethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(C)=N/[H])c1ccc(Oc2cc(C(=O)NCCS(C)=O)ccc2CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C24H28N4O4S2/c1-16(25)33-23(26)17-7-9-20(10-8-17)32-21-14-18(24(30)27-11-13-34(2)31)5-6-19(21)15-28-12-3-4-22(28)29/h5-10,14,25-26H,3-4,11-13,15H2,1-2H3,(H,27,30)/b25-16+,26-23- |
| InChIKey | FJAXRMNEZPTPCF-IYLGLBRYSA-N |
| XLogP | 3.77 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|