C25H28F2N4O3S — CID 144948170
2-methylpropanimidoyl 4-[5-(2,2-difluoroethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate (PubChem CID 144948170) has the molecular formula C25H28F2N4O3S and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-methylpropanimidoyl 4-[5-(2,2-difluoroethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate.
| Compound Name | 2-methylpropanimidoyl 4-[5-(2,2-difluoroethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate |
|---|---|
| PubChem CID | 144948170 |
| Molecular Formula | C25H28F2N4O3S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-methylpropanimidoyl 4-[5-(2,2-difluoroethylcarbamoyl)-2-[(2-oxopyrrolidin-1-yl)methyl]phenoxy]benzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])C(C)C)c1ccc(Oc2cc(C(=O)NCC(F)F)ccc2CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C25H28F2N4O3S/c1-15(2)23(28)35-24(29)16-7-9-19(10-8-16)34-20-12-17(25(33)30-13-21(26)27)5-6-18(20)14-31-11-3-4-22(31)32/h5-10,12,15,21,28-29H,3-4,11,13-14H2,1-2H3,(H,30,33)/b28-23+,29-24- |
| InChIKey | XZLTTWOELRKBAI-ABHBNJMISA-N |
| XLogP | 5.29 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|