C33H35ClN2O4 — CID 144948500
2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]-2-cyclopropylacetic acid (PubChem CID 144948500) has the molecular formula C33H35ClN2O4 and a molecular weight of 559.11 g/mol. Its IUPAC name is 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]-2-cyclopropylacetic acid.
| Compound Name | 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]-2-cyclopropylacetic acid |
|---|---|
| PubChem CID | 144948500 |
| Molecular Formula | C33H35ClN2O4 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]-2-cyclopropylacetic acid |
| SMILES | Cc1c(C)n(Cc2ccc(Cl)c(OC(C(=O)O)C3CC3)c2)c2ccc(C(=O)NCc3cccc(C(C)C)c3)cc12 |
| InChI | InChI=1S/C33H35ClN2O4/c1-19(2)25-7-5-6-22(14-25)17-35-32(37)26-11-13-29-27(16-26)20(3)21(4)36(29)18-23-8-12-28(34)30(15-23)40-31(33(38)39)24-9-10-24/h5-8,11-16,19,24,31H,9-10,17-18H2,1-4H3,(H,35,37)(H,38,39) |
| InChIKey | FJZMTHSBCXAAIL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|