C31H33ClN2O4 — CID 144948640
methyl 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]acetate (PubChem CID 144948640) has the molecular formula C31H33ClN2O4 and a molecular weight of 533.07 g/mol. Its IUPAC name is methyl 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 144948640 |
| Molecular Formula | C31H33ClN2O4 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | methyl 2-[2-chloro-5-[[2,3-dimethyl-5-[(3-propan-2-ylphenyl)methylcarbamoyl]indol-1-yl]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cc(Cn2c(C)c(C)c3cc(C(=O)NCc4cccc(C(C)C)c4)ccc32)ccc1Cl |
| InChI | InChI=1S/C31H33ClN2O4/c1-19(2)24-8-6-7-22(13-24)16-33-31(36)25-10-12-28-26(15-25)20(3)21(4)34(28)17-23-9-11-27(32)29(14-23)38-18-30(35)37-5/h6-15,19H,16-18H2,1-5H3,(H,33,36) |
| InChIKey | DNSVWMKIPRAESX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|