C25H27FN6O2 — CID 144948965
N-[(Z)-5-amino-4-methanimidoylpent-4-enyl]-3-(4-fluorophenyl)-2-morpholin-4-ylquinoxaline-6-carboxamide (PubChem CID 144948965) has the molecular formula C25H27FN6O2 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(Z)-5-amino-4-methanimidoylpent-4-enyl]-3-(4-fluorophenyl)-2-morpholin-4-ylquinoxaline-6-carboxamide.
| Compound Name | N-[(Z)-5-amino-4-methanimidoylpent-4-enyl]-3-(4-fluorophenyl)-2-morpholin-4-ylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 144948965 |
| Molecular Formula | C25H27FN6O2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[(Z)-5-amino-4-methanimidoylpent-4-enyl]-3-(4-fluorophenyl)-2-morpholin-4-ylquinoxaline-6-carboxamide |
| SMILES | [H]/N=C/C(=C\N)CCCNC(=O)c1ccc2nc(N3CCOCC3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C25H27FN6O2/c26-20-6-3-18(4-7-20)23-24(32-10-12-34-13-11-32)31-21-8-5-19(14-22(21)30-23)25(33)29-9-1-2-17(15-27)16-28/h3-8,14-16,27H,1-2,9-13,28H2,(H,29,33)/b17-16-,27-15+ |
| InChIKey | OZTUCTUGXWRXMC-PZPRAILTSA-N |
| XLogP | 3.27 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|