C26H30N3O+ — CID 144950855
2-cyclopentyl-5-methyl-6-[[4-(6-methyl-1,2-dihydropyridazin-2-ium-4-yl)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 144950855) has the molecular formula C26H30N3O+ and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-cyclopentyl-5-methyl-6-[[4-(6-methyl-1,2-dihydropyridazin-2-ium-4-yl)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 2-cyclopentyl-5-methyl-6-[[4-(6-methyl-1,2-dihydropyridazin-2-ium-4-yl)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 144950855 |
| Molecular Formula | C26H30N3O+ |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-cyclopentyl-5-methyl-6-[[4-(6-methyl-1,2-dihydropyridazin-2-ium-4-yl)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | CC1=CC(c2ccc(Cc3cc4c(cc3C)CN(C3CCCC3)C4=O)cc2)=C[NH2+]N1 |
| InChI | InChI=1S/C26H29N3O/c1-17-11-23-16-29(24-5-3-4-6-24)26(30)25(23)14-21(17)13-19-7-9-20(10-8-19)22-12-18(2)28-27-15-22/h7-12,14-15,24,27-28H,3-6,13,16H2,1-2H3/p+1 |
| InChIKey | XXSTWVDTXUGHEH-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|