C23H30N2O4S — CID 144951914
N-methylhydroxylamine;2-methylsulfinyl-3-[3-[4-(4-propylphenyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanal (PubChem CID 144951914) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-methylhydroxylamine;2-methylsulfinyl-3-[3-[4-(4-propylphenyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanal.
| Compound Name | N-methylhydroxylamine;2-methylsulfinyl-3-[3-[4-(4-propylphenyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanal |
|---|---|
| PubChem CID | 144951914 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-methylhydroxylamine;2-methylsulfinyl-3-[3-[4-(4-propylphenyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanal |
| SMILES | CCCc1ccc(-c2ccc(C3=NOC(CC(C=O)S(C)=O)C3)cc2)cc1.CNO |
| InChI | InChI=1S/C22H25NO3S.CH5NO/c1-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)22-14-20(26-23-22)13-21(15-24)27(2)25;1-2-3/h5-12,15,20-21H,3-4,13-14H2,1-2H3;2-3H,1H3 |
| InChIKey | CMTKNYIQBRGBMV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|