C16H17N3O5S2 — CID 123706740
N-hydroxy-2-methylsulfonyl-3-[3-[4-(1,2-thiazol-4-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide (PubChem CID 123706740) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-hydroxy-2-methylsulfonyl-3-[3-[4-(1,2-thiazol-4-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide.
| Compound Name | N-hydroxy-2-methylsulfonyl-3-[3-[4-(1,2-thiazol-4-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide |
|---|---|
| PubChem CID | 123706740 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-hydroxy-2-methylsulfonyl-3-[3-[4-(1,2-thiazol-4-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide |
| SMILES | CS(=O)(=O)C(CC1CC(c2ccc(-c3cnsc3)cc2)=NO1)C(=O)NO |
| InChI | InChI=1S/C16H17N3O5S2/c1-26(22,23)15(16(20)18-21)7-13-6-14(19-24-13)11-4-2-10(3-5-11)12-8-17-25-9-12/h2-5,8-9,13,15,21H,6-7H2,1H3,(H,18,20) |
| InChIKey | YFKYYRNACFTKQA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|